About amino 2-nitroethanesulfonate
amino 2-nitroethanesulfonate (PubChem CID 134595076) has the molecular formula C2H6N2O5S
and a molecular weight of 170.15 g/mol. Its IUPAC name is amino 2-nitroethanesulfonate.
Molecular Properties
| Compound Name | amino 2-nitroethanesulfonate |
| PubChem CID | 134595076 |
| Molecular Formula | C2H6N2O5S |
| Molecular Weight | 170.15 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | amino 2-nitroethanesulfonate |
| SMILES | NOS(=O)(=O)CC[N+](=O)[O-] |
| InChI | InChI=1S/C2H6N2O5S/c3-9-10(7,8)2-1-4(5)6/h1-3H2 |
| InChIKey | BNRASSXDMBYONM-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 112.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.15 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 2-nitroethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 2-nitroethanesulfonate?
The IUPAC name of amino 2-nitroethanesulfonate (CID 134595076) is amino 2-nitroethanesulfonate.
What is the SMILES notation for amino 2-nitroethanesulfonate?
The canonical SMILES for amino 2-nitroethanesulfonate is NOS(=O)(=O)CC[N+](=O)[O-].
What is the InChIKey of amino 2-nitroethanesulfonate?
The InChIKey is BNRASSXDMBYONM-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N2O5S/c3-9-10(7,8)2-1-4(5)6/h1-3H2.
What are the key properties of amino 2-nitroethanesulfonate?
amino 2-nitroethanesulfonate has a molecular weight of 170.15 g/mol, XLogP of -1.52, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for amino 2-nitroethanesulfonate is sourced from PubChem (CID 134595076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).