C11H20N2 — CID 134595250
N-(3,3-dimethylbutan-2-ylidene)-N'-prop-1-en-2-ylethanimidamide (PubChem CID 134595250) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-ylidene)-N'-prop-1-en-2-ylethanimidamide.
| Compound Name | N-(3,3-dimethylbutan-2-ylidene)-N'-prop-1-en-2-ylethanimidamide |
|---|---|
| PubChem CID | 134595250 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | N-(3,3-dimethylbutan-2-ylidene)-N'-prop-1-en-2-ylethanimidamide |
| SMILES | C=C(C)/N=C(C)/N=C(\C)C(C)(C)C |
| InChI | InChI=1S/C11H20N2/c1-8(2)12-10(4)13-9(3)11(5,6)7/h1H2,2-7H3/b12-10+,13-9+ |
| InChIKey | SNBPSPBZIYXXPA-DSEBWEOJSA-N |
| XLogP | 3.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|