C15H18FN5S — CID 134595270
3-[(8-fluoro-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N,N-dimethylpropan-1-amine (PubChem CID 134595270) has the molecular formula C15H18FN5S and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-[(8-fluoro-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(8-fluoro-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 134595270 |
| Molecular Formula | C15H18FN5S |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 3-[(8-fluoro-5-methyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCSc1nnc2c3cc(F)ccc3n(C)c2n1 |
| InChI | InChI=1S/C15H18FN5S/c1-20(2)7-4-8-22-15-17-14-13(18-19-15)11-9-10(16)5-6-12(11)21(14)3/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | YQPVAWKXBUUOGW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|