C18H16F3N3S — CID 134595379
1-[2-ethylsulfanyl-4-(trifluoromethyl)phenyl]-4-(4-methylphenyl)triazole (PubChem CID 134595379) has the molecular formula C18H16F3N3S and a molecular weight of 363.41 g/mol. Its IUPAC name is 1-[2-ethylsulfanyl-4-(trifluoromethyl)phenyl]-4-(4-methylphenyl)triazole.
| Compound Name | 1-[2-ethylsulfanyl-4-(trifluoromethyl)phenyl]-4-(4-methylphenyl)triazole |
|---|---|
| PubChem CID | 134595379 |
| Molecular Formula | C18H16F3N3S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 1-[2-ethylsulfanyl-4-(trifluoromethyl)phenyl]-4-(4-methylphenyl)triazole |
| SMILES | CCSc1cc(C(F)(F)F)ccc1-n1cc(-c2ccc(C)cc2)nn1 |
| InChI | InChI=1S/C18H16F3N3S/c1-3-25-17-10-14(18(19,20)21)8-9-16(17)24-11-15(22-23-24)13-6-4-12(2)5-7-13/h4-11H,3H2,1-2H3 |
| InChIKey | UFTJDTNCSOVTMA-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |