C30H40N2O7 — CID 134595406
2-(2-formylphenoxy)-N-[4-[4-[[2-(2-formylphenoxy)acetyl]amino]-3,3-dimethylbutoxy]-4-methylpentyl]acetamide (PubChem CID 134595406) has the molecular formula C30H40N2O7 and a molecular weight of 540.66 g/mol. Its IUPAC name is 2-(2-formylphenoxy)-N-[4-[4-[[2-(2-formylphenoxy)acetyl]amino]-3,3-dimethylbutoxy]-4-methylpentyl]acetamide.
| Compound Name | 2-(2-formylphenoxy)-N-[4-[4-[[2-(2-formylphenoxy)acetyl]amino]-3,3-dimethylbutoxy]-4-methylpentyl]acetamide |
|---|---|
| PubChem CID | 134595406 |
| Molecular Formula | C30H40N2O7 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.28 |
| IUPAC Name | 2-(2-formylphenoxy)-N-[4-[4-[[2-(2-formylphenoxy)acetyl]amino]-3,3-dimethylbutoxy]-4-methylpentyl]acetamide |
| SMILES | CC(C)(CCOC(C)(C)CCCNC(=O)COc1ccccc1C=O)CNC(=O)COc1ccccc1C=O |
| InChI | InChI=1S/C30H40N2O7/c1-29(2,22-32-28(36)21-38-26-13-8-6-11-24(26)19-34)15-17-39-30(3,4)14-9-16-31-27(35)20-37-25-12-7-5-10-23(25)18-33/h5-8,10-13,18-19H,9,14-17,20-22H2,1-4H3,(H,31,35)(H,32,36) |
| InChIKey | QWANXKLGDKXZQQ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|