About 1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol
1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol (PubChem CID 134595647) has the molecular formula C13H19F2N3O
and a molecular weight of 271.31 g/mol. Its IUPAC name is 1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol.
Molecular Properties
| Compound Name | 1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol |
| PubChem CID | 134595647 |
| Molecular Formula | C13H19F2N3O |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol |
| SMILES | CC(C)(C)c1ccc(N2CCC(O)C(F)(F)C2)nn1 |
| InChI | InChI=1S/C13H19F2N3O/c1-12(2,3)9-4-5-11(17-16-9)18-7-6-10(19)13(14,15)8-18/h4-5,10,19H,6-8H2,1-3H3 |
| InChIKey | ZCHZGIQCFNKMMM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol?
The IUPAC name of 1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol (CID 134595647) is 1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol.
What is the SMILES notation for 1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol?
The canonical SMILES for 1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol is CC(C)(C)c1ccc(N2CCC(O)C(F)(F)C2)nn1.
What is the InChIKey of 1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol?
The InChIKey is ZCHZGIQCFNKMMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19F2N3O/c1-12(2,3)9-4-5-11(17-16-9)18-7-6-10(19)13(14,15)8-18/h4-5,10,19H,6-8H2,1-3H3.
What are the key properties of 1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol?
1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol has a molecular weight of 271.31 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-tert-butylpyridazin-3-yl)-3,3-difluoropiperidin-4-ol is sourced from PubChem (CID 134595647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).