About (Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide
(Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide (PubChem CID 134595890) has the molecular formula C9H14IN3
and a molecular weight of 291.14 g/mol. Its IUPAC name is (Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide |
| PubChem CID | 134595890 |
| Molecular Formula | C9H14IN3 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | (Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide |
| SMILES | C/C=C\C=C(/C)N/C=C\C(N)=NI |
| InChI | InChI=1S/C9H14IN3/c1-3-4-5-8(2)12-7-6-9(11)13-10/h3-7,12H,1-2H3,(H2,11,13)/b4-3-,7-6-,8-5+ |
| InChIKey | XXOGJYAIVCSYIU-UDPIHMSGSA-N |
| XLogP | 2.28 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide?
The IUPAC name of (Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide (CID 134595890) is (Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide.
What is the SMILES notation for (Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide?
The canonical SMILES for (Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide is C/C=C\C=C(/C)N/C=C\C(N)=NI.
What is the InChIKey of (Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide?
The InChIKey is XXOGJYAIVCSYIU-UDPIHMSGSA-N. The full InChI is InChI=1S/C9H14IN3/c1-3-4-5-8(2)12-7-6-9(11)13-10/h3-7,12H,1-2H3,(H2,11,13)/b4-3-,7-6-,8-5+.
What are the key properties of (Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide?
(Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide has a molecular weight of 291.14 g/mol, XLogP of 2.28, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-[[(2E,4Z)-hexa-2,4-dien-2-yl]amino]-N'-iodoprop-2-enimidamide is sourced from PubChem (CID 134595890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).