C56H36F2N4 — CID 134595915
3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine (PubChem CID 134595915) has the molecular formula C56H36F2N4 and a molecular weight of 802.93 g/mol. Its IUPAC name is 3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine.
| Compound Name | 3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine |
|---|---|
| PubChem CID | 134595915 |
| Molecular Formula | C56H36F2N4 |
| Molecular Weight | 802.93 g/mol |
| Exact Mass | 802.29 |
| IUPAC Name | 3-[3-(4,6-diphenylpyrimidin-2-yl)phenyl]-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine |
| SMILES | Cc1c2c(-c3ccc(F)cc3)nc3cc(-c4cccc(-c5nc(-c6ccccc6)cc(-c6ccccc6)n5)c4)ccc3c2c(C)c2c(-c3ccc(F)cc3)nc3ccccc3c12 |
| InChI | InChI=1S/C56H36F2N4/c1-33-50-44-18-9-10-19-46(44)59-54(37-20-25-42(57)26-21-37)52(50)34(2)51-45-29-24-40(31-49(45)60-55(53(33)51)38-22-27-43(58)28-23-38)39-16-11-17-41(30-39)56-61-47(35-12-5-3-6-13-35)32-48(62-56)36-14-7-4-8-15-36/h3-32H,1-2H3 |
| InChIKey | JOOLPWXMOAHWCB-UHFFFAOYSA-N |
| XLogP | 14.78 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 802.93 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|