C50H32F2N4 — CID 134595919
3-(3,5-dipyridin-2-ylphenyl)-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine (PubChem CID 134595919) has the molecular formula C50H32F2N4 and a molecular weight of 726.83 g/mol. Its IUPAC name is 3-(3,5-dipyridin-2-ylphenyl)-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine.
| Compound Name | 3-(3,5-dipyridin-2-ylphenyl)-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine |
|---|---|
| PubChem CID | 134595919 |
| Molecular Formula | C50H32F2N4 |
| Molecular Weight | 726.83 g/mol |
| Exact Mass | 726.26 |
| IUPAC Name | 3-(3,5-dipyridin-2-ylphenyl)-6,13-bis(4-fluorophenyl)-7,14-dimethylquinolino[4,3-j]phenanthridine |
| SMILES | Cc1c2c(-c3ccc(F)cc3)nc3cc(-c4cc(-c5ccccn5)cc(-c5ccccn5)c4)ccc3c2c(C)c2c(-c3ccc(F)cc3)nc3ccccc3c12 |
| InChI | InChI=1S/C50H32F2N4/c1-29-45-39-9-3-4-12-43(39)55-49(31-13-18-37(51)19-14-31)47(45)30(2)46-40-22-17-33(28-44(40)56-50(48(29)46)32-15-20-38(52)21-16-32)34-25-35(41-10-5-7-23-53-41)27-36(26-34)42-11-6-8-24-54-42/h3-28H,1-2H3 |
| InChIKey | SKIOEPSCWXKUAY-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.83 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|