C20H17F2N3O3 — CID 134596501
N-[(Z)-1-amino-3-anilinoprop-2-enylidene]-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide (PubChem CID 134596501) has the molecular formula C20H17F2N3O3 and a molecular weight of 385.37 g/mol. Its IUPAC name is N-[(Z)-1-amino-3-anilinoprop-2-enylidene]-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide.
| Compound Name | N-[(Z)-1-amino-3-anilinoprop-2-enylidene]-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134596501 |
| Molecular Formula | C20H17F2N3O3 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N-[(Z)-1-amino-3-anilinoprop-2-enylidene]-1-(2,2-difluoro-1,3-benzodioxol-5-yl)cyclopropane-1-carboxamide |
| SMILES | NC(/C=C\Nc1ccccc1)=N\C(=O)C1(c2ccc3c(c2)OC(F)(F)O3)CC1 |
| InChI | InChI=1S/C20H17F2N3O3/c21-20(22)27-15-7-6-13(12-16(15)28-20)19(9-10-19)18(26)25-17(23)8-11-24-14-4-2-1-3-5-14/h1-8,11-12,24H,9-10H2,(H2,23,25,26)/b11-8- |
| InChIKey | XUKRLLAGMLRBOP-FLIBITNWSA-N |
| XLogP | 3.55 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|