C19H14FN5O — CID 134596540
N-[1-(5-cyano-3-pyridinyl)pyrazol-3-yl]-1-(2-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 134596540) has the molecular formula C19H14FN5O and a molecular weight of 347.35 g/mol. Its IUPAC name is N-[1-(5-cyano-3-pyridinyl)pyrazol-3-yl]-1-(2-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[1-(5-cyano-3-pyridinyl)pyrazol-3-yl]-1-(2-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 134596540 |
| Molecular Formula | C19H14FN5O |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | N-[1-(5-cyano-3-pyridinyl)pyrazol-3-yl]-1-(2-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | N#Cc1cncc(-n2ccc(NC(=O)C3(c4ccccc4F)CC3)n2)c1 |
| InChI | InChI=1S/C19H14FN5O/c20-16-4-2-1-3-15(16)19(6-7-19)18(26)23-17-5-8-25(24-17)14-9-13(10-21)11-22-12-14/h1-5,8-9,11-12H,6-7H2,(H,23,24,26) |
| InChIKey | UHUVPDKXAJPKGZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |