C12H17NO7 — CID 134597162
1-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3,5-dimethoxyoxolan-2-yl]pyridine-2,4-dione (PubChem CID 134597162) has the molecular formula C12H17NO7 and a molecular weight of 287.27 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3,5-dimethoxyoxolan-2-yl]pyridine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3,5-dimethoxyoxolan-2-yl]pyridine-2,4-dione |
|---|---|
| PubChem CID | 134597162 |
| Molecular Formula | C12H17NO7 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-4-hydroxy-5-(hydroxymethyl)-3,5-dimethoxyoxolan-2-yl]pyridine-2,4-dione |
| SMILES | CO[C@H]1[C@H](N2C=CC(=O)CC2=O)O[C@@](CO)(OC)[C@H]1O |
| InChI | InChI=1S/C12H17NO7/c1-18-9-10(17)12(6-14,19-2)20-11(9)13-4-3-7(15)5-8(13)16/h3-4,9-11,14,17H,5-6H2,1-2H3/t9-,10+,11-,12-/m1/s1 |
| InChIKey | YGGLFCBWNDVIEP-WRWGMCAJSA-N |
| XLogP | -1.63 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|