C58H67N3 — CID 134597488
4-[bis[4-(2,4,6-trimethyl-N-propylanilino)phenyl]methyl]-N-[(4-butan-2-ylphenyl)methyl]naphthalen-1-amine (PubChem CID 134597488) has the molecular formula C58H67N3 and a molecular weight of 806.20 g/mol. Its IUPAC name is 4-[bis[4-(2,4,6-trimethyl-N-propylanilino)phenyl]methyl]-N-[(4-butan-2-ylphenyl)methyl]naphthalen-1-amine.
| Compound Name | 4-[bis[4-(2,4,6-trimethyl-N-propylanilino)phenyl]methyl]-N-[(4-butan-2-ylphenyl)methyl]naphthalen-1-amine |
|---|---|
| PubChem CID | 134597488 |
| Molecular Formula | C58H67N3 |
| Molecular Weight | 806.20 g/mol |
| Exact Mass | 805.53 |
| IUPAC Name | 4-[bis[4-(2,4,6-trimethyl-N-propylanilino)phenyl]methyl]-N-[(4-butan-2-ylphenyl)methyl]naphthalen-1-amine |
| SMILES | CCCN(c1ccc(C(c2ccc(N(CCC)c3c(C)cc(C)cc3C)cc2)c2ccc(NCc3ccc(C(C)CC)cc3)c3ccccc23)cc1)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C58H67N3/c1-11-32-60(57-42(7)34-39(4)35-43(57)8)50-26-22-48(23-27-50)56(49-24-28-51(29-25-49)61(33-12-2)58-44(9)36-40(5)37-45(58)10)54-30-31-55(53-17-15-14-16-52(53)54)59-38-46-18-20-47(21-19-46)41(6)13-3/h14-31,34-37,41,56,59H,11-13,32-33,38H2,1-10H3 |
| InChIKey | HUQMCEKAYPCZNQ-UHFFFAOYSA-N |
| XLogP | 16.09 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.20 |
| LogP ≤ 5 | 16.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|