C69H43N7 — CID 134598155
2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenylindolo[3,2-c]carbazol-12-yl]-5,12-diphenylindolo[3,2-c]carbazole (PubChem CID 134598155) has the molecular formula C69H43N7 and a molecular weight of 970.15 g/mol. Its IUPAC name is 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenylindolo[3,2-c]carbazol-12-yl]-5,12-diphenylindolo[3,2-c]carbazole.
| Compound Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenylindolo[3,2-c]carbazol-12-yl]-5,12-diphenylindolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 134598155 |
| Molecular Formula | C69H43N7 |
| Molecular Weight | 970.15 g/mol |
| Exact Mass | 969.36 |
| IUPAC Name | 2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)-5-phenylindolo[3,2-c]carbazol-12-yl]-5,12-diphenylindolo[3,2-c]carbazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc4c5c(ccc6c7ccccc7n(-c7ccc8c(c7)c7c(ccc9c%10ccccc%10n(-c%10ccccc%10)c97)n8-c7ccccc7)c65)n(-c5ccccc5)c34)n2)cc1 |
| InChI | InChI=1S/C69H43N7/c1-6-21-44(22-7-1)67-70-68(45-23-8-2-9-24-45)72-69(71-67)55-34-20-33-54-62-61(75(64(54)55)48-29-14-5-15-30-48)42-39-52-51-32-17-19-36-58(51)76(65(52)62)49-37-40-59-56(43-49)63-60(73(59)46-25-10-3-11-26-46)41-38-53-50-31-16-18-35-57(50)74(66(53)63)47-27-12-4-13-28-47/h1-43H |
| InChIKey | HIKAAUGTKWPGSZ-UHFFFAOYSA-N |
| XLogP | 17.26 |
| TPSA | 58.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 970.15 |
| LogP ≤ 5 | 17.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |