C43H35NO2 — CID 134598415
(Z)-3-[6-(N-(9,9-dimethylfluoren-2-yl)anilino)pyren-1-yl]-4-methoxypent-3-en-2-one (PubChem CID 134598415) has the molecular formula C43H35NO2 and a molecular weight of 597.76 g/mol. Its IUPAC name is (Z)-3-[6-(N-(9,9-dimethylfluoren-2-yl)anilino)pyren-1-yl]-4-methoxypent-3-en-2-one.
| Compound Name | (Z)-3-[6-(N-(9,9-dimethylfluoren-2-yl)anilino)pyren-1-yl]-4-methoxypent-3-en-2-one |
|---|---|
| PubChem CID | 134598415 |
| Molecular Formula | C43H35NO2 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.27 |
| IUPAC Name | (Z)-3-[6-(N-(9,9-dimethylfluoren-2-yl)anilino)pyren-1-yl]-4-methoxypent-3-en-2-one |
| SMILES | CO/C(C)=C(\C(C)=O)c1ccc2ccc3c(N(c4ccccc4)c4ccc5c(c4)C(C)(C)c4ccccc4-5)ccc4ccc1c2c43 |
| InChI | InChI=1S/C43H35NO2/c1-26(45)40(27(2)46-5)34-20-15-28-17-22-36-39(24-18-29-16-21-35(34)41(28)42(29)36)44(30-11-7-6-8-12-30)31-19-23-33-32-13-9-10-14-37(32)43(3,4)38(33)25-31/h6-25H,1-5H3/b40-27+ |
| InChIKey | BLZAUQNHFIQFFV-WOQJSSNBSA-N |
| XLogP | 11.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 11.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|