C20H19F2N7O2S — CID 134598850
(7S)-N-(2,2-difluoroethyl)-4-[(6-methoxypyrazolo[1,5-a]pyrimidin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide (PubChem CID 134598850) has the molecular formula C20H19F2N7O2S and a molecular weight of 459.48 g/mol. Its IUPAC name is (7S)-N-(2,2-difluoroethyl)-4-[(6-methoxypyrazolo[1,5-a]pyrimidin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | (7S)-N-(2,2-difluoroethyl)-4-[(6-methoxypyrazolo[1,5-a]pyrimidin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 134598850 |
| Molecular Formula | C20H19F2N7O2S |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | (7S)-N-(2,2-difluoroethyl)-4-[(6-methoxypyrazolo[1,5-a]pyrimidin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidine-7-carboxamide |
| SMILES | COc1cn2nccc2nc1Nc1ncnc2sc3c(c12)CC[C@H](C(=O)NCC(F)F)C3 |
| InChI | InChI=1S/C20H19F2N7O2S/c1-31-12-8-29-15(4-5-26-29)27-17(12)28-18-16-11-3-2-10(19(30)23-7-14(21)22)6-13(11)32-20(16)25-9-24-18/h4-5,8-10,14H,2-3,6-7H2,1H3,(H,23,30)(H,24,25,27,28)/t10-/m0/s1 |
| InChIKey | UGGSIUOQKBBFHF-JTQLQIEISA-N |
| XLogP | 2.97 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |