C25H25F3N4O4 — CID 134599059
(2R,4R)-7-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-N-(3-fluoro-4-methylphenyl)-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide (PubChem CID 134599059) has the molecular formula C25H25F3N4O4 and a molecular weight of 502.49 g/mol. Its IUPAC name is (2R,4R)-7-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-N-(3-fluoro-4-methylphenyl)-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide.
| Compound Name | (2R,4R)-7-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-N-(3-fluoro-4-methylphenyl)-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide |
|---|---|
| PubChem CID | 134599059 |
| Molecular Formula | C25H25F3N4O4 |
| Molecular Weight | 502.49 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | (2R,4R)-7-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-N-(3-fluoro-4-methylphenyl)-8-methyl-1-azatricyclo[4.3.0.02,4]nona-6,8-diene-9-carboxamide |
| SMILES | CNC(=O)C1(NC(=O)C(=O)c2c(C)c(C(=O)Nc3ccc(C)c(F)c3)n3c2C[C@H]2C[C@H]23)CC(F)(F)C1 |
| InChI | InChI=1S/C25H25F3N4O4/c1-11-4-5-14(8-15(11)26)30-21(34)19-12(2)18(17-7-13-6-16(13)32(17)19)20(33)22(35)31-24(23(36)29-3)9-25(27,28)10-24/h4-5,8,13,16H,6-7,9-10H2,1-3H3,(H,29,36)(H,30,34)(H,31,35)/t13-,16-/m1/s1 |
| InChIKey | LZQJTGZXDUYBSV-CZUORRHYSA-N |
| XLogP | 2.83 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.49 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|