About 3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide
3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide (PubChem CID 13459942) has the molecular formula C14H13O4P
and a molecular weight of 276.23 g/mol. Its IUPAC name is 3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide.
Molecular Properties
| Compound Name | 3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide |
| PubChem CID | 13459942 |
| Molecular Formula | C14H13O4P |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide |
| SMILES | O=P1(Oc2ccccc2)OCc2ccccc2CO1 |
| InChI | InChI=1S/C14H13O4P/c15-19(18-14-8-2-1-3-9-14)16-10-12-6-4-5-7-13(12)11-17-19/h1-9H,10-11H2 |
| InChIKey | KNANCGNTEHKQLX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide?
The IUPAC name of 3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide (CID 13459942) is 3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide.
What is the SMILES notation for 3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide?
The canonical SMILES for 3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide is O=P1(Oc2ccccc2)OCc2ccccc2CO1.
What is the InChIKey of 3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide?
The InChIKey is KNANCGNTEHKQLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13O4P/c15-19(18-14-8-2-1-3-9-14)16-10-12-6-4-5-7-13(12)11-17-19/h1-9H,10-11H2.
What are the key properties of 3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide?
3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide has a molecular weight of 276.23 g/mol, XLogP of 3.92, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenoxy-1,5-dihydro-2,4,3lambda5-benzodioxaphosphepine 3-oxide is sourced from PubChem (CID 13459942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).