About 6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline
6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline (PubChem CID 134599526) has the molecular formula C28H17BrN4
and a molecular weight of 489.38 g/mol. Its IUPAC name is 6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline.
Molecular Properties
| Compound Name | 6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline |
| PubChem CID | 134599526 |
| Molecular Formula | C28H17BrN4 |
| Molecular Weight | 489.38 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline |
| SMILES | Brc1cc2ccc(-c3ccc(-c4ccc(-c5ncccn5)cc4)cc3)nc2c2ncccc12 |
| InChI | InChI=1S/C28H17BrN4/c29-24-17-22-12-13-25(33-26(22)27-23(24)3-1-14-30-27)20-8-4-18(5-9-20)19-6-10-21(11-7-19)28-31-15-2-16-32-28/h1-17H |
| InChIKey | JYKUQNFGICRYIL-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.38 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline?
The IUPAC name of 6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline (CID 134599526) is 6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline.
What is the SMILES notation for 6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline?
The canonical SMILES for 6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline is Brc1cc2ccc(-c3ccc(-c4ccc(-c5ncccn5)cc4)cc3)nc2c2ncccc12.
What is the InChIKey of 6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline?
The InChIKey is JYKUQNFGICRYIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H17BrN4/c29-24-17-22-12-13-25(33-26(22)27-23(24)3-1-14-30-27)20-8-4-18(5-9-20)19-6-10-21(11-7-19)28-31-15-2-16-32-28/h1-17H.
What are the key properties of 6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline?
6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline has a molecular weight of 489.38 g/mol, XLogP of 7.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-[4-(4-pyrimidin-2-ylphenyl)phenyl]-1,10-phenanthroline is sourced from PubChem (CID 134599526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).