About hexyl 2-oxo-1,3-dioxolane-4-carboxylate
hexyl 2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 134599617) has the molecular formula C10H16O5
and a molecular weight of 216.23 g/mol. Its IUPAC name is hexyl 2-oxo-1,3-dioxolane-4-carboxylate.
Molecular Properties
| Compound Name | hexyl 2-oxo-1,3-dioxolane-4-carboxylate |
| PubChem CID | 134599617 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | hexyl 2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | CCCCCCOC(=O)C1COC(=O)O1 |
| InChI | InChI=1S/C10H16O5/c1-2-3-4-5-6-13-9(11)8-7-14-10(12)15-8/h8H,2-7H2,1H3 |
| InChIKey | SQSQODBMRQMCRY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexyl 2-oxo-1,3-dioxolane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexyl 2-oxo-1,3-dioxolane-4-carboxylate?
The IUPAC name of hexyl 2-oxo-1,3-dioxolane-4-carboxylate (CID 134599617) is hexyl 2-oxo-1,3-dioxolane-4-carboxylate.
What is the SMILES notation for hexyl 2-oxo-1,3-dioxolane-4-carboxylate?
The canonical SMILES for hexyl 2-oxo-1,3-dioxolane-4-carboxylate is CCCCCCOC(=O)C1COC(=O)O1.
What is the InChIKey of hexyl 2-oxo-1,3-dioxolane-4-carboxylate?
The InChIKey is SQSQODBMRQMCRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O5/c1-2-3-4-5-6-13-9(11)8-7-14-10(12)15-8/h8H,2-7H2,1H3.
What are the key properties of hexyl 2-oxo-1,3-dioxolane-4-carboxylate?
hexyl 2-oxo-1,3-dioxolane-4-carboxylate has a molecular weight of 216.23 g/mol, XLogP of 1.65, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hexyl 2-oxo-1,3-dioxolane-4-carboxylate is sourced from PubChem (CID 134599617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).