About 2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate
2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 134599623) has the molecular formula C6H5F3O5
and a molecular weight of 214.09 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate.
Molecular Properties
| Compound Name | 2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate |
| PubChem CID | 134599623 |
| Molecular Formula | C6H5F3O5 |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 214.01 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | O=C1OCC(C(=O)OCC(F)(F)F)O1 |
| InChI | InChI=1S/C6H5F3O5/c7-6(8,9)2-13-4(10)3-1-12-5(11)14-3/h3H,1-2H2 |
| InChIKey | MRZBQMQKIXAVES-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate?
The IUPAC name of 2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate (CID 134599623) is 2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate.
What is the SMILES notation for 2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate?
The canonical SMILES for 2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate is O=C1OCC(C(=O)OCC(F)(F)F)O1.
What is the InChIKey of 2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate?
The InChIKey is MRZBQMQKIXAVES-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F3O5/c7-6(8,9)2-13-4(10)3-1-12-5(11)14-3/h3H,1-2H2.
What are the key properties of 2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate?
2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate has a molecular weight of 214.09 g/mol, XLogP of 0.63, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoroethyl 2-oxo-1,3-dioxolane-4-carboxylate is sourced from PubChem (CID 134599623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).