C7H4F6O5 — CID 134599624
1,1,1,3,3,3-hexafluoropropan-2-yl 2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 134599624) has the molecular formula C7H4F6O5 and a molecular weight of 282.09 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-oxo-1,3-dioxolane-4-carboxylate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-oxo-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 134599624 |
| Molecular Formula | C7H4F6O5 |
| Molecular Weight | 282.09 g/mol |
| Exact Mass | 282.00 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | O=C1OCC(C(=O)OC(C(F)(F)F)C(F)(F)F)O1 |
| InChI | InChI=1S/C7H4F6O5/c8-6(9,10)4(7(11,12)13)18-3(14)2-1-16-5(15)17-2/h2,4H,1H2 |
| InChIKey | INZJVGOFEYGSRH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.09 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |