About prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate
prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate (PubChem CID 134599663) has the molecular formula C9H10O5
and a molecular weight of 198.17 g/mol. Its IUPAC name is prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate.
Molecular Properties
| Compound Name | prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate |
| PubChem CID | 134599663 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate |
| SMILES | C#CCOC(=O)C1(CC)COC(=O)O1 |
| InChI | InChI=1S/C9H10O5/c1-3-5-12-7(10)9(4-2)6-13-8(11)14-9/h1H,4-6H2,2H3 |
| InChIKey | UAHZZIYIZSYUDA-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate?
The IUPAC name of prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate (CID 134599663) is prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate.
What is the SMILES notation for prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate?
The canonical SMILES for prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate is C#CCOC(=O)C1(CC)COC(=O)O1.
What is the InChIKey of prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate?
The InChIKey is UAHZZIYIZSYUDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O5/c1-3-5-12-7(10)9(4-2)6-13-8(11)14-9/h1H,4-6H2,2H3.
What are the key properties of prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate?
prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate has a molecular weight of 198.17 g/mol, XLogP of 0.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-ynyl 4-ethyl-2-oxo-1,3-dioxolane-4-carboxylate is sourced from PubChem (CID 134599663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).