C15H11N5O2S — CID 134600287
N-methyl-6-oxo-7-pyridin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 134600287) has the molecular formula C15H11N5O2S and a molecular weight of 325.35 g/mol. Its IUPAC name is N-methyl-6-oxo-7-pyridin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-methyl-6-oxo-7-pyridin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 134600287 |
| Molecular Formula | C15H11N5O2S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | N-methyl-6-oxo-7-pyridin-3-yl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | CNC(=O)c1sc2nccc3c2c1NC(=O)N3c1cccnc1 |
| InChI | InChI=1S/C15H11N5O2S/c1-16-13(21)12-11-10-9(4-6-18-14(10)23-12)20(15(22)19-11)8-3-2-5-17-7-8/h2-7H,1H3,(H,16,21)(H,19,22) |
| InChIKey | QSSQIMQEGGHWFT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |