C30H29N5O3S — CID 134600368
N-(2-acetamidocyclopentyl)-6-methylidene-7-(2-methyl-4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 134600368) has the molecular formula C30H29N5O3S and a molecular weight of 539.66 g/mol. Its IUPAC name is N-(2-acetamidocyclopentyl)-6-methylidene-7-(2-methyl-4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-(2-acetamidocyclopentyl)-6-methylidene-7-(2-methyl-4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 134600368 |
| Molecular Formula | C30H29N5O3S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | N-(2-acetamidocyclopentyl)-6-methylidene-7-(2-methyl-4-phenoxyphenyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=c1[nH]c2c(C(=O)NC3CCCC3NC(C)=O)sc3nccc(c32)n1-c1ccc(Oc2ccccc2)cc1C |
| InChI | InChI=1S/C30H29N5O3S/c1-17-16-21(38-20-8-5-4-6-9-20)12-13-24(17)35-18(2)32-27-26-25(35)14-15-31-30(26)39-28(27)29(37)34-23-11-7-10-22(23)33-19(3)36/h4-6,8-9,12-16,22-23,32H,2,7,10-11H2,1,3H3,(H,33,36)(H,34,37) |
| InChIKey | VYZSGHGUUCTESR-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 101.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |