About 2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole
2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole (PubChem CID 134600372) has the molecular formula C11H11F3N2
and a molecular weight of 228.22 g/mol. Its IUPAC name is 2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole.
Molecular Properties
| Compound Name | 2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole |
| PubChem CID | 134600372 |
| Molecular Formula | C11H11F3N2 |
| Molecular Weight | 228.22 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole |
| SMILES | Cc1nccn1C1=CCC(C(F)(F)F)C=C1 |
| InChI | InChI=1S/C11H11F3N2/c1-8-15-6-7-16(8)10-4-2-9(3-5-10)11(12,13)14/h2,4-7,9H,3H2,1H3 |
| InChIKey | NXRSTMXHRYGAKK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.22 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole?
The IUPAC name of 2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole (CID 134600372) is 2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole.
What is the SMILES notation for 2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole?
The canonical SMILES for 2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole is Cc1nccn1C1=CCC(C(F)(F)F)C=C1.
What is the InChIKey of 2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole?
The InChIKey is NXRSTMXHRYGAKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3N2/c1-8-15-6-7-16(8)10-4-2-9(3-5-10)11(12,13)14/h2,4-7,9H,3H2,1H3.
What are the key properties of 2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole?
2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole has a molecular weight of 228.22 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-[4-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]imidazole is sourced from PubChem (CID 134600372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).