C32H32N6O2S — CID 134600386
N-[(1R)-2-(buta-1,3-dien-2-ylamino)cyclohexyl]-6-methylidene-7-(4-methyl-6-phenoxy-3-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 134600386) has the molecular formula C32H32N6O2S and a molecular weight of 564.72 g/mol. Its IUPAC name is N-[(1R)-2-(buta-1,3-dien-2-ylamino)cyclohexyl]-6-methylidene-7-(4-methyl-6-phenoxy-3-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | N-[(1R)-2-(buta-1,3-dien-2-ylamino)cyclohexyl]-6-methylidene-7-(4-methyl-6-phenoxy-3-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 134600386 |
| Molecular Formula | C32H32N6O2S |
| Molecular Weight | 564.72 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | N-[(1R)-2-(buta-1,3-dien-2-ylamino)cyclohexyl]-6-methylidene-7-(4-methyl-6-phenoxy-3-pyridinyl)-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=C)NC1CCCC[C@H]1NC(=O)c1sc2nccc3c2c1[nH]c(=C)n3-c1cnc(Oc2ccccc2)cc1C |
| InChI | InChI=1S/C32H32N6O2S/c1-5-20(3)35-23-13-9-10-14-24(23)37-31(39)30-29-28-25(15-16-33-32(28)41-30)38(21(4)36-29)26-18-34-27(17-19(26)2)40-22-11-7-6-8-12-22/h5-8,11-12,15-18,23-24,35-36H,1,3-4,9-10,13-14H2,2H3,(H,37,39)/t23?,24-/m1/s1 |
| InChIKey | MPSUWJGJBZOABI-XMMISQBUSA-N |
| XLogP | 6.09 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.72 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|