C16H17F2N3O — CID 134600539
5-[(3R,8S)-6-(1,1-difluoroethyl)-6-methyl-5-oxo-2,3,7,8-tetrahydro-1H-pyrrolizin-3-yl]pyridine-3-carbonitrile (PubChem CID 134600539) has the molecular formula C16H17F2N3O and a molecular weight of 305.33 g/mol. Its IUPAC name is 5-[(3R,8S)-6-(1,1-difluoroethyl)-6-methyl-5-oxo-2,3,7,8-tetrahydro-1H-pyrrolizin-3-yl]pyridine-3-carbonitrile.
| Compound Name | 5-[(3R,8S)-6-(1,1-difluoroethyl)-6-methyl-5-oxo-2,3,7,8-tetrahydro-1H-pyrrolizin-3-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 134600539 |
| Molecular Formula | C16H17F2N3O |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 5-[(3R,8S)-6-(1,1-difluoroethyl)-6-methyl-5-oxo-2,3,7,8-tetrahydro-1H-pyrrolizin-3-yl]pyridine-3-carbonitrile |
| SMILES | CC(F)(F)C1(C)C[C@@H]2CC[C@H](c3cncc(C#N)c3)N2C1=O |
| InChI | InChI=1S/C16H17F2N3O/c1-15(16(2,17)18)6-12-3-4-13(21(12)14(15)22)11-5-10(7-19)8-20-9-11/h5,8-9,12-13H,3-4,6H2,1-2H3/t12-,13+,15?/m0/s1 |
| InChIKey | MWHKRNBONGOLTC-IKCIUXDWSA-N |
| XLogP | 3.05 |
| TPSA | 56.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |