About [(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol
[(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol (PubChem CID 13460063) has the molecular formula C7H13NO
and a molecular weight of 127.19 g/mol. Its IUPAC name is [(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol.
Molecular Properties
| Compound Name | [(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol |
| PubChem CID | 13460063 |
| Molecular Formula | C7H13NO |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.10 |
| IUPAC Name | [(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol |
| SMILES | N[C@@H]1CC=CC[C@@H]1CO |
| InChI | InChI=1S/C7H13NO/c8-7-4-2-1-3-6(7)5-9/h1-2,6-7,9H,3-5,8H2/t6-,7-/m1/s1 |
| InChIKey | SZLMSKCXLLFJEI-RNFRBKRXSA-N |
| XLogP | 0.27 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol?
The IUPAC name of [(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol (CID 13460063) is [(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol.
What is the SMILES notation for [(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol?
The canonical SMILES for [(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol is N[C@@H]1CC=CC[C@@H]1CO.
What is the InChIKey of [(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol?
The InChIKey is SZLMSKCXLLFJEI-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H13NO/c8-7-4-2-1-3-6(7)5-9/h1-2,6-7,9H,3-5,8H2/t6-,7-/m1/s1.
What are the key properties of [(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol?
[(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol has a molecular weight of 127.19 g/mol, XLogP of 0.27, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,6R)-6-aminocyclohex-3-en-1-yl]methanol is sourced from PubChem (CID 13460063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).