C8H11NOS — CID 13460087
(4aS,8aR)-1,4,4a,5,8,8a-hexahydro-3,1-benzoxazine-2-thione (PubChem CID 13460087) has the molecular formula C8H11NOS and a molecular weight of 169.25 g/mol. Its IUPAC name is (4aS,8aR)-1,4,4a,5,8,8a-hexahydro-3,1-benzoxazine-2-thione.
| Compound Name | (4aS,8aR)-1,4,4a,5,8,8a-hexahydro-3,1-benzoxazine-2-thione |
|---|---|
| PubChem CID | 13460087 |
| Molecular Formula | C8H11NOS |
| Molecular Weight | 169.25 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | (4aS,8aR)-1,4,4a,5,8,8a-hexahydro-3,1-benzoxazine-2-thione |
| SMILES | S=C1N[C@@H]2CC=CC[C@@H]2CO1 |
| InChI | InChI=1S/C8H11NOS/c11-8-9-7-4-2-1-3-6(7)5-10-8/h1-2,6-7H,3-5H2,(H,9,11)/t6-,7-/m1/s1 |
| InChIKey | ZLQYJSOIAHWDPI-RNFRBKRXSA-N |
| XLogP | 1.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|