C8H11NO2 — CID 13460089
(4aR,8aR)-1,4,4a,5,8,8a-hexahydro-3,1-benzoxazin-2-one (PubChem CID 13460089) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is (4aR,8aR)-1,4,4a,5,8,8a-hexahydro-3,1-benzoxazin-2-one.
| Compound Name | (4aR,8aR)-1,4,4a,5,8,8a-hexahydro-3,1-benzoxazin-2-one |
|---|---|
| PubChem CID | 13460089 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (4aR,8aR)-1,4,4a,5,8,8a-hexahydro-3,1-benzoxazin-2-one |
| SMILES | O=C1N[C@@H]2CC=CC[C@H]2CO1 |
| InChI | InChI=1S/C8H11NO2/c10-8-9-7-4-2-1-3-6(7)5-11-8/h1-2,6-7H,3-5H2,(H,9,10)/t6-,7+/m0/s1 |
| InChIKey | NUFHTZDANBNUED-NKWVEPMBSA-N |
| XLogP | 1.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|