C39H57N3O2 — CID 134601334
ethyl 3-[3-amino-5-ethyl-4-(methylamino)phenyl]-3-[3-[2,2-dimethylpropyl-[(2Z,3Z)-2-pentan-2-ylidenehexa-3,5-dienyl]amino]-2,3-dihydro-1H-inden-5-yl]propanoate (PubChem CID 134601334) has the molecular formula C39H57N3O2 and a molecular weight of 599.90 g/mol. Its IUPAC name is ethyl 3-[3-amino-5-ethyl-4-(methylamino)phenyl]-3-[3-[2,2-dimethylpropyl-[(2Z,3Z)-2-pentan-2-ylidenehexa-3,5-dienyl]amino]-2,3-dihydro-1H-inden-5-yl]propanoate.
| Compound Name | ethyl 3-[3-amino-5-ethyl-4-(methylamino)phenyl]-3-[3-[2,2-dimethylpropyl-[(2Z,3Z)-2-pentan-2-ylidenehexa-3,5-dienyl]amino]-2,3-dihydro-1H-inden-5-yl]propanoate |
|---|---|
| PubChem CID | 134601334 |
| Molecular Formula | C39H57N3O2 |
| Molecular Weight | 599.90 g/mol |
| Exact Mass | 599.45 |
| IUPAC Name | ethyl 3-[3-amino-5-ethyl-4-(methylamino)phenyl]-3-[3-[2,2-dimethylpropyl-[(2Z,3Z)-2-pentan-2-ylidenehexa-3,5-dienyl]amino]-2,3-dihydro-1H-inden-5-yl]propanoate |
| SMILES | C=C/C=C\C(CN(CC(C)(C)C)C1CCc2ccc(C(CC(=O)OCC)c3cc(N)c(NC)c(CC)c3)cc21)=C(/C)CCC |
| InChI | InChI=1S/C39H57N3O2/c1-10-14-16-31(27(5)15-11-2)25-42(26-39(6,7)8)36-20-19-29-17-18-30(22-34(29)36)33(24-37(43)44-13-4)32-21-28(12-3)38(41-9)35(40)23-32/h10,14,16-18,21-23,33,36,41H,1,11-13,15,19-20,24-26,40H2,2-9H3/b16-14-,31-27- |
| InChIKey | JFFASMMBPDNKAM-UHZORDRQSA-N |
| XLogP | 9.15 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.90 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|