C22H28N2O2 — CID 134601371
3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-(2,3-dihydro-1H-inden-5-yl)-2,2-dimethylpropanoic acid (PubChem CID 134601371) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-(2,3-dihydro-1H-inden-5-yl)-2,2-dimethylpropanoic acid.
| Compound Name | 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-(2,3-dihydro-1H-inden-5-yl)-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 134601371 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 3-[3-amino-2-methyl-4-(methylamino)phenyl]-3-(2,3-dihydro-1H-inden-5-yl)-2,2-dimethylpropanoic acid |
| SMILES | CNc1ccc(C(c2ccc3c(c2)CCC3)C(C)(C)C(=O)O)c(C)c1N |
| InChI | InChI=1S/C22H28N2O2/c1-13-17(10-11-18(24-4)20(13)23)19(22(2,3)21(25)26)16-9-8-14-6-5-7-15(14)12-16/h8-12,19,24H,5-7,23H2,1-4H3,(H,25,26) |
| InChIKey | ORVQJDZNTZLEHF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|