C57H35N7 — CID 134601853
4-[6-(4-cyanophenyl)-3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7,14-dimethylquinolino[4,3-j]phenanthridin-13-yl]benzonitrile (PubChem CID 134601853) has the molecular formula C57H35N7 and a molecular weight of 817.96 g/mol. Its IUPAC name is 4-[6-(4-cyanophenyl)-3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7,14-dimethylquinolino[4,3-j]phenanthridin-13-yl]benzonitrile.
| Compound Name | 4-[6-(4-cyanophenyl)-3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7,14-dimethylquinolino[4,3-j]phenanthridin-13-yl]benzonitrile |
|---|---|
| PubChem CID | 134601853 |
| Molecular Formula | C57H35N7 |
| Molecular Weight | 817.96 g/mol |
| Exact Mass | 817.30 |
| IUPAC Name | 4-[6-(4-cyanophenyl)-3-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-7,14-dimethylquinolino[4,3-j]phenanthridin-13-yl]benzonitrile |
| SMILES | Cc1c2c(-c3ccc(C#N)cc3)nc3cc(-c4ccc(-c5nc(-c6ccccc6)nc(-c6ccccc6)n5)cc4)ccc3c2c(C)c2c(-c3ccc(C#N)cc3)nc3ccccc3c12 |
| InChI | InChI=1S/C57H35N7/c1-34-49-45-15-9-10-16-47(45)60-53(39-21-17-36(32-58)18-22-39)51(49)35(2)50-46-30-29-44(31-48(46)61-54(52(34)50)40-23-19-37(33-59)20-24-40)38-25-27-43(28-26-38)57-63-55(41-11-5-3-6-12-41)62-56(64-57)42-13-7-4-8-14-42/h3-31H,1-2H3 |
| InChIKey | YYDLSJCTCUAZON-UHFFFAOYSA-N |
| XLogP | 13.64 |
| TPSA | 112.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.96 |
| LogP ≤ 5 | 13.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|