C44H27N4OP — CID 134602601
6-[(7-cyano-9-phenylcarbazol-3-yl)-phenylphosphoryl]-9-phenylcarbazole-2-carbonitrile (PubChem CID 134602601) has the molecular formula C44H27N4OP and a molecular weight of 658.70 g/mol. Its IUPAC name is 6-[(7-cyano-9-phenylcarbazol-3-yl)-phenylphosphoryl]-9-phenylcarbazole-2-carbonitrile.
| Compound Name | 6-[(7-cyano-9-phenylcarbazol-3-yl)-phenylphosphoryl]-9-phenylcarbazole-2-carbonitrile |
|---|---|
| PubChem CID | 134602601 |
| Molecular Formula | C44H27N4OP |
| Molecular Weight | 658.70 g/mol |
| Exact Mass | 658.19 |
| IUPAC Name | 6-[(7-cyano-9-phenylcarbazol-3-yl)-phenylphosphoryl]-9-phenylcarbazole-2-carbonitrile |
| SMILES | N#Cc1ccc2c3cc(P(=O)(c4ccccc4)c4ccc5c(c4)c4ccc(C#N)cc4n5-c4ccccc4)ccc3n(-c3ccccc3)c2c1 |
| InChI | InChI=1S/C44H27N4OP/c45-28-30-16-20-37-39-26-35(18-22-41(39)47(43(37)24-30)32-10-4-1-5-11-32)50(49,34-14-8-3-9-15-34)36-19-23-42-40(27-36)38-21-17-31(29-46)25-44(38)48(42)33-12-6-2-7-13-33/h1-27H |
| InChIKey | CMNQYWBZRQZTOM-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 74.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.70 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|