C21H27O3P — CID 134602664
(2S,3S)-4-(2,6-dimethoxy-3,5-dimethylphenyl)-3-methyl-2-propan-2-yl-2H-1,3-benzoxaphosphole (PubChem CID 134602664) has the molecular formula C21H27O3P and a molecular weight of 358.42 g/mol. Its IUPAC name is (2S,3S)-4-(2,6-dimethoxy-3,5-dimethylphenyl)-3-methyl-2-propan-2-yl-2H-1,3-benzoxaphosphole.
| Compound Name | (2S,3S)-4-(2,6-dimethoxy-3,5-dimethylphenyl)-3-methyl-2-propan-2-yl-2H-1,3-benzoxaphosphole |
|---|---|
| PubChem CID | 134602664 |
| Molecular Formula | C21H27O3P |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | (2S,3S)-4-(2,6-dimethoxy-3,5-dimethylphenyl)-3-methyl-2-propan-2-yl-2H-1,3-benzoxaphosphole |
| SMILES | COc1c(C)cc(C)c(OC)c1-c1cccc2c1[P@](C)[C@@H](C(C)C)O2 |
| InChI | InChI=1S/C21H27O3P/c1-12(2)21-24-16-10-8-9-15(20(16)25(21)7)17-18(22-5)13(3)11-14(4)19(17)23-6/h8-12,21H,1-7H3/t21-,25-/m0/s1 |
| InChIKey | VEEIHONDTMOHBE-OFVILXPXSA-N |
| XLogP | 5.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|