C20H17FO3S — CID 13460269
2-(benzenesulfonyl)-2-fluoro-1,1-diphenylethanol (PubChem CID 13460269) has the molecular formula C20H17FO3S and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2-fluoro-1,1-diphenylethanol.
| Compound Name | 2-(benzenesulfonyl)-2-fluoro-1,1-diphenylethanol |
|---|---|
| PubChem CID | 13460269 |
| Molecular Formula | C20H17FO3S |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 2-(benzenesulfonyl)-2-fluoro-1,1-diphenylethanol |
| SMILES | O=S(=O)(c1ccccc1)C(F)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H17FO3S/c21-19(25(23,24)18-14-8-3-9-15-18)20(22,16-10-4-1-5-11-16)17-12-6-2-7-13-17/h1-15,19,22H |
| InChIKey | MPMJUIUSUFCZKX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |