C18H26N2O2 — CID 134603004
(2R,6S)-4-[6-(prop-2-ynylamino)hexyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione (PubChem CID 134603004) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (2R,6S)-4-[6-(prop-2-ynylamino)hexyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione.
| Compound Name | (2R,6S)-4-[6-(prop-2-ynylamino)hexyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
|---|---|
| PubChem CID | 134603004 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (2R,6S)-4-[6-(prop-2-ynylamino)hexyl]-4-azatricyclo[5.2.1.02,6]decane-3,5-dione |
| SMILES | C#CCNCCCCCCN1C(=O)[C@@H]2C3CCC(C3)[C@@H]2C1=O |
| InChI | InChI=1S/C18H26N2O2/c1-2-9-19-10-5-3-4-6-11-20-17(21)15-13-7-8-14(12-13)16(15)18(20)22/h1,13-16,19H,3-12H2/t13?,14?,15-,16+ |
| InChIKey | ABXNLWQMHAUVAC-STONLHKKSA-N |
| XLogP | 1.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|