C25H50N4 — CID 134603103
(2S)-4-[2-[(3R,4S)-1-[2-[(3R,4R)-1,4-dimethylpiperidin-3-yl]ethyl]-4,5,5-trimethylpiperidin-3-yl]ethyl]-1,2-dimethylpiperazine (PubChem CID 134603103) has the molecular formula C25H50N4 and a molecular weight of 406.70 g/mol. Its IUPAC name is (2S)-4-[2-[(3R,4S)-1-[2-[(3R,4R)-1,4-dimethylpiperidin-3-yl]ethyl]-4,5,5-trimethylpiperidin-3-yl]ethyl]-1,2-dimethylpiperazine.
| Compound Name | (2S)-4-[2-[(3R,4S)-1-[2-[(3R,4R)-1,4-dimethylpiperidin-3-yl]ethyl]-4,5,5-trimethylpiperidin-3-yl]ethyl]-1,2-dimethylpiperazine |
|---|---|
| PubChem CID | 134603103 |
| Molecular Formula | C25H50N4 |
| Molecular Weight | 406.70 g/mol |
| Exact Mass | 406.40 |
| IUPAC Name | (2S)-4-[2-[(3R,4S)-1-[2-[(3R,4R)-1,4-dimethylpiperidin-3-yl]ethyl]-4,5,5-trimethylpiperidin-3-yl]ethyl]-1,2-dimethylpiperazine |
| SMILES | C[C@@H]1CCN(C)C[C@@H]1CCN1C[C@H](CCN2CCN(C)[C@@H](C)C2)[C@H](C)C(C)(C)C1 |
| InChI | InChI=1S/C25H50N4/c1-20-8-11-26(6)17-23(20)9-13-29-18-24(22(3)25(4,5)19-29)10-12-28-15-14-27(7)21(2)16-28/h20-24H,8-19H2,1-7H3/t20-,21+,22+,23+,24+/m1/s1 |
| InChIKey | KTAYFPKKKBJLJM-DFWAIWNTSA-N |
| XLogP | 3.58 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.70 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |