C22H31N7O2 — CID 134603495
5-(4-tert-butylphenyl)-7-[3-(4-hydroxypiperidin-1-yl)propylamino]-1H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-2-one (PubChem CID 134603495) has the molecular formula C22H31N7O2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-7-[3-(4-hydroxypiperidin-1-yl)propylamino]-1H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-2-one.
| Compound Name | 5-(4-tert-butylphenyl)-7-[3-(4-hydroxypiperidin-1-yl)propylamino]-1H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-2-one |
|---|---|
| PubChem CID | 134603495 |
| Molecular Formula | C22H31N7O2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 5-(4-tert-butylphenyl)-7-[3-(4-hydroxypiperidin-1-yl)propylamino]-1H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-2-one |
| SMILES | CC(C)(C)c1ccc(-c2nc(NCCCN3CCC(O)CC3)n3[nH]c(=O)nc3n2)cc1 |
| InChI | InChI=1S/C22H31N7O2/c1-22(2,3)16-7-5-15(6-8-16)18-24-19(29-20(25-18)26-21(31)27-29)23-11-4-12-28-13-9-17(30)10-14-28/h5-8,17,30H,4,9-14H2,1-3H3,(H2,23,24,25,26,27,31) |
| InChIKey | AUKFLTQZXODTJK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 111.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|