C10H15F2NO2 — CID 134603930
(2Z,4Z)-N-ethenyl-4,5-difluoro-3,6-dimethoxyhexa-2,4-dien-2-amine (PubChem CID 134603930) has the molecular formula C10H15F2NO2 and a molecular weight of 219.23 g/mol. Its IUPAC name is (2Z,4Z)-N-ethenyl-4,5-difluoro-3,6-dimethoxyhexa-2,4-dien-2-amine.
| Compound Name | (2Z,4Z)-N-ethenyl-4,5-difluoro-3,6-dimethoxyhexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 134603930 |
| Molecular Formula | C10H15F2NO2 |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | (2Z,4Z)-N-ethenyl-4,5-difluoro-3,6-dimethoxyhexa-2,4-dien-2-amine |
| SMILES | C=CN/C(C)=C(OC)/C(F)=C(/F)COC |
| InChI | InChI=1S/C10H15F2NO2/c1-5-13-7(2)10(15-4)9(12)8(11)6-14-3/h5,13H,1,6H2,2-4H3/b9-8-,10-7- |
| InChIKey | LOEQHIILOSYGSP-NFIXMJHSSA-N |
| XLogP | 2.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|