C13H15F3N6 — CID 134604113
1-(diaminomethylidene)-2-[2-(4,5,6-trifluoro-1,8-dihydrocyclohepta[b]pyrrol-3-yl)ethyl]guanidine (PubChem CID 134604113) has the molecular formula C13H15F3N6 and a molecular weight of 312.30 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[2-(4,5,6-trifluoro-1,8-dihydrocyclohepta[b]pyrrol-3-yl)ethyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[2-(4,5,6-trifluoro-1,8-dihydrocyclohepta[b]pyrrol-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 134604113 |
| Molecular Formula | C13H15F3N6 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 1-(diaminomethylidene)-2-[2-(4,5,6-trifluoro-1,8-dihydrocyclohepta[b]pyrrol-3-yl)ethyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/CCc1c[nH]c2c1C(F)=C(F)C(F)=CC2 |
| InChI | InChI=1S/C13H15F3N6/c14-7-1-2-8-9(11(16)10(7)15)6(5-21-8)3-4-20-13(19)22-12(17)18/h1,5,21H,2-4H2,(H6,17,18,19,20,22) |
| InChIKey | YUYNSYWRZWDOQQ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|