C44H30N4 — CID 134604240
1-[(1Z)-buta-1,3-dienyl]-2-methyl-3-phenyl-10-(9-phenylcarbazol-3-yl)pyrrolo[3,2-a]carbazole-6-carbonitrile (PubChem CID 134604240) has the molecular formula C44H30N4 and a molecular weight of 614.75 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-2-methyl-3-phenyl-10-(9-phenylcarbazol-3-yl)pyrrolo[3,2-a]carbazole-6-carbonitrile.
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-2-methyl-3-phenyl-10-(9-phenylcarbazol-3-yl)pyrrolo[3,2-a]carbazole-6-carbonitrile |
|---|---|
| PubChem CID | 134604240 |
| Molecular Formula | C44H30N4 |
| Molecular Weight | 614.75 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-2-methyl-3-phenyl-10-(9-phenylcarbazol-3-yl)pyrrolo[3,2-a]carbazole-6-carbonitrile |
| SMILES | C=C/C=C\c1c(C)n(-c2ccccc2)c2ccc3c4c(C#N)cccc4n(-c4ccc5c(c4)c4ccccc4n5-c4ccccc4)c3c12 |
| InChI | InChI=1S/C44H30N4/c1-3-4-19-34-29(2)46(31-15-7-5-8-16-31)41-26-24-36-42-30(28-45)14-13-22-40(42)48(44(36)43(34)41)33-23-25-39-37(27-33)35-20-11-12-21-38(35)47(39)32-17-9-6-10-18-32/h3-27H,1H2,2H3/b19-4- |
| InChIKey | ICYAGMSDXICRKJ-PVOVUMCXSA-N |
| XLogP | 11.20 |
| TPSA | 38.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.75 |
| LogP ≤ 5 | 11.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|