C22H29N5O4 — CID 134604396
(2Z,4E)-2,5-diamino-N-(3-hydroxycyclohexyl)-5-[[5-methyl-3-(6-methyl-3-pyridinyl)-1,2-oxazol-4-yl]methoxy]penta-2,4-dienamide (PubChem CID 134604396) has the molecular formula C22H29N5O4 and a molecular weight of 427.51 g/mol. Its IUPAC name is (2Z,4E)-2,5-diamino-N-(3-hydroxycyclohexyl)-5-[[5-methyl-3-(6-methyl-3-pyridinyl)-1,2-oxazol-4-yl]methoxy]penta-2,4-dienamide.
| Compound Name | (2Z,4E)-2,5-diamino-N-(3-hydroxycyclohexyl)-5-[[5-methyl-3-(6-methyl-3-pyridinyl)-1,2-oxazol-4-yl]methoxy]penta-2,4-dienamide |
|---|---|
| PubChem CID | 134604396 |
| Molecular Formula | C22H29N5O4 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.22 |
| IUPAC Name | (2Z,4E)-2,5-diamino-N-(3-hydroxycyclohexyl)-5-[[5-methyl-3-(6-methyl-3-pyridinyl)-1,2-oxazol-4-yl]methoxy]penta-2,4-dienamide |
| SMILES | Cc1ccc(-c2noc(C)c2CO/C(N)=C/C=C(\N)C(=O)NC2CCCC(O)C2)cn1 |
| InChI | InChI=1S/C22H29N5O4/c1-13-6-7-15(11-25-13)21-18(14(2)31-27-21)12-30-20(24)9-8-19(23)22(29)26-16-4-3-5-17(28)10-16/h6-9,11,16-17,28H,3-5,10,12,23-24H2,1-2H3,(H,26,29)/b19-8-,20-9+ |
| InChIKey | WRWCWNKRGJSPQL-CQXXYOPLSA-N |
| XLogP | 1.93 |
| TPSA | 149.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|