C13H24N4 — CID 134604692
7-(2,3,3-trimethylpentan-2-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine (PubChem CID 134604692) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 7-(2,3,3-trimethylpentan-2-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine.
| Compound Name | 7-(2,3,3-trimethylpentan-2-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
|---|---|
| PubChem CID | 134604692 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 7-(2,3,3-trimethylpentan-2-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine |
| SMILES | CCC(C)(C)C(C)(C)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C13H24N4/c1-6-12(2,3)13(4,5)17-8-7-16-10-14-15-11(16)9-17/h10H,6-9H2,1-5H3 |
| InChIKey | YTLHXICPZIOQCC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |