C24H25ClN6O2S — CID 134604845
[(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methanone (PubChem CID 134604845) has the molecular formula C24H25ClN6O2S and a molecular weight of 497.02 g/mol. Its IUPAC name is [(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methanone.
| Compound Name | [(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 134604845 |
| Molecular Formula | C24H25ClN6O2S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | [(7S)-4-[(6-chloropyrazolo[1,5-a]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-[(2R)-2-(methoxymethyl)pyrrolidin-1-yl]methanone |
| SMILES | COC[C@H]1CCCN1C(=O)[C@H]1CCc2c(sc3ncnc(Nc4cc5ccnn5cc4Cl)c23)C1 |
| InChI | InChI=1S/C24H25ClN6O2S/c1-33-12-16-3-2-8-30(16)24(32)14-4-5-17-20(9-14)34-23-21(17)22(26-13-27-23)29-19-10-15-6-7-28-31(15)11-18(19)25/h6-7,10-11,13-14,16H,2-5,8-9,12H2,1H3,(H,26,27,29)/t14-,16+/m0/s1 |
| InChIKey | IHODOCQGRIGHSN-GOEBONIOSA-N |
| XLogP | 4.48 |
| TPSA | 84.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |