C19H39P — CID 134604877
(2,2,4,5,5,6,6,7-octamethyl-8-methylidenedecan-3-yl)phosphane (PubChem CID 134604877) has the molecular formula C19H39P and a molecular weight of 298.50 g/mol. Its IUPAC name is (2,2,4,5,5,6,6,7-octamethyl-8-methylidenedecan-3-yl)phosphane.
| Compound Name | (2,2,4,5,5,6,6,7-octamethyl-8-methylidenedecan-3-yl)phosphane |
|---|---|
| PubChem CID | 134604877 |
| Molecular Formula | C19H39P |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.28 |
| IUPAC Name | (2,2,4,5,5,6,6,7-octamethyl-8-methylidenedecan-3-yl)phosphane |
| SMILES | C=C(CC)C(C)C(C)(C)C(C)(C)C(C)C(P)C(C)(C)C |
| InChI | InChI=1S/C19H39P/c1-12-13(2)14(3)18(8,9)19(10,11)15(4)16(20)17(5,6)7/h14-16H,2,12,20H2,1,3-11H3 |
| InChIKey | IRFICOVNVGSEBI-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|