C32H35F6NO3 — CID 134604893
(2S,3R)-3-[2-[2-[(1S)-1-[2,5-bis(trifluoromethyl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptan-5-yl]-3,4-dihydro-2H-chromen-7-yl]-3-cyclopropyl-2-methylpropanoic acid (PubChem CID 134604893) has the molecular formula C32H35F6NO3 and a molecular weight of 595.62 g/mol. Its IUPAC name is (2S,3R)-3-[2-[2-[(1S)-1-[2,5-bis(trifluoromethyl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptan-5-yl]-3,4-dihydro-2H-chromen-7-yl]-3-cyclopropyl-2-methylpropanoic acid.
| Compound Name | (2S,3R)-3-[2-[2-[(1S)-1-[2,5-bis(trifluoromethyl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptan-5-yl]-3,4-dihydro-2H-chromen-7-yl]-3-cyclopropyl-2-methylpropanoic acid |
|---|---|
| PubChem CID | 134604893 |
| Molecular Formula | C32H35F6NO3 |
| Molecular Weight | 595.62 g/mol |
| Exact Mass | 595.25 |
| IUPAC Name | (2S,3R)-3-[2-[2-[(1S)-1-[2,5-bis(trifluoromethyl)phenyl]ethyl]-2-azabicyclo[2.2.1]heptan-5-yl]-3,4-dihydro-2H-chromen-7-yl]-3-cyclopropyl-2-methylpropanoic acid |
| SMILES | C[C@H](C(=O)O)[C@H](c1ccc2c(c1)OC(C1CC3CC1CN3[C@@H](C)c1cc(C(F)(F)F)ccc1C(F)(F)F)CC2)C1CC1 |
| InChI | InChI=1S/C32H35F6NO3/c1-16(30(40)41)29(19-4-5-19)20-6-3-18-7-10-27(42-28(18)12-20)25-14-23-11-21(25)15-39(23)17(2)24-13-22(31(33,34)35)8-9-26(24)32(36,37)38/h3,6,8-9,12-13,16-17,19,21,23,25,27,29H,4-5,7,10-11,14-15H2,1-2H3,(H,40,41)/t16-,17-,21?,23?,25?,27?,29-/m0/s1 |
| InChIKey | DYMPASCBTMJAJP-KROBUWHYSA-N |
| XLogP | 8.10 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.62 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |