C25H24ClF3N4O4 — CID 134605021
(2S,3S,4R)-N-(3-chloro-4-fluorophenyl)-9-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-3,8-dimethyl-6-azatricyclo[4.3.0.02,4]nona-1(9),7-diene-7-carboxamide (PubChem CID 134605021) has the molecular formula C25H24ClF3N4O4 and a molecular weight of 536.94 g/mol. Its IUPAC name is (2S,3S,4R)-N-(3-chloro-4-fluorophenyl)-9-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-3,8-dimethyl-6-azatricyclo[4.3.0.02,4]nona-1(9),7-diene-7-carboxamide.
| Compound Name | (2S,3S,4R)-N-(3-chloro-4-fluorophenyl)-9-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-3,8-dimethyl-6-azatricyclo[4.3.0.02,4]nona-1(9),7-diene-7-carboxamide |
|---|---|
| PubChem CID | 134605021 |
| Molecular Formula | C25H24ClF3N4O4 |
| Molecular Weight | 536.94 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | (2S,3S,4R)-N-(3-chloro-4-fluorophenyl)-9-[2-[[3,3-difluoro-1-(methylcarbamoyl)cyclobutyl]amino]-2-oxoacetyl]-3,8-dimethyl-6-azatricyclo[4.3.0.02,4]nona-1(9),7-diene-7-carboxamide |
| SMILES | CNC(=O)C1(NC(=O)C(=O)c2c(C)c(C(=O)Nc3ccc(F)c(Cl)c3)n3c2[C@H]2[C@@H](C)[C@H]2C3)CC(F)(F)C1 |
| InChI | InChI=1S/C25H24ClF3N4O4/c1-10-13-7-33-18(21(35)31-12-4-5-15(27)14(26)6-12)11(2)17(19(33)16(10)13)20(34)22(36)32-24(23(37)30-3)8-25(28,29)9-24/h4-6,10,13,16H,7-9H2,1-3H3,(H,30,37)(H,31,35)(H,32,36)/t10-,13+,16-/m0/s1 |
| InChIKey | HWWOUHGOGSSAPL-WNMQOVRZSA-N |
| XLogP | 3.42 |
| TPSA | 109.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.94 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|