C11H13IN2O2 — CID 134605040
ethyl 1-[6-(iodoamino)-3-pyridinyl]cyclopropane-1-carboxylate (PubChem CID 134605040) has the molecular formula C11H13IN2O2 and a molecular weight of 332.14 g/mol. Its IUPAC name is ethyl 1-[6-(iodoamino)-3-pyridinyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 1-[6-(iodoamino)-3-pyridinyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 134605040 |
| Molecular Formula | C11H13IN2O2 |
| Molecular Weight | 332.14 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | ethyl 1-[6-(iodoamino)-3-pyridinyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(c2ccc(NI)nc2)CC1 |
| InChI | InChI=1S/C11H13IN2O2/c1-2-16-10(15)11(5-6-11)8-3-4-9(14-12)13-7-8/h3-4,7H,2,5-6H2,1H3,(H,13,14) |
| InChIKey | HRCZXMVTJWBWKT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|